741221-1G Display Image

Bis(benzonitrile)palladium(II) bromide, 95%

Code: 741221-1G D2-231

Packaging

1 g in glass bottle

£99.50 1G
List Price

reaction suitabilityreaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction suitabilityreaction type: Hiyama Coupling
reaction suitabilityreaction type: Heck Reaction
reaction suitabilityreaction type: Sonogashira Coupling
reaction suitabilityreaction type: Suzuki-Miyaura Coupling
reaction suitabilityreaction type: Negishi Coupling
reaction suitabilityreaction type: Stille Coupling
reaction suitabilityreagent type: catalyst
InChI1S/2C7H5N.2BrH.Pd/c2*8-6-7-4-2-1-3-5-7;;;/h2*1-5H;2*1H;/q;;;;+2/p-2
assay95%
Quality Level100
mp95-102 °C
SMILES stringBr[Pd]Br.N#Cc1ccccc1.N#Cc2ccccc2
InChI keyOKDHIPXOBPPHTG-UHFFFAOYSA-L

Cas Number0015003-43-7